About (3S)-3-ethyloctane-1,8-diol
(3S)-3-ethyloctane-1,8-diol (PubChem CID 118889766) has the molecular formula C10H22O2
and a molecular weight of 174.28 g/mol. Its IUPAC name is (3S)-3-ethyloctane-1,8-diol.
Molecular Properties
| Compound Name | (3S)-3-ethyloctane-1,8-diol |
| PubChem CID | 118889766 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | (3S)-3-ethyloctane-1,8-diol |
| SMILES | CC[C@H](CCO)CCCCCO |
| InChI | InChI=1S/C10H22O2/c1-2-10(7-9-12)6-4-3-5-8-11/h10-12H,2-9H2,1H3/t10-/m0/s1 |
| InChIKey | SEGKJLWPIPSYSC-JTQLQIEISA-N |
| XLogP | 1.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-ethyloctane-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-ethyloctane-1,8-diol?
The IUPAC name of (3S)-3-ethyloctane-1,8-diol (CID 118889766) is (3S)-3-ethyloctane-1,8-diol.
What is the SMILES notation for (3S)-3-ethyloctane-1,8-diol?
The canonical SMILES for (3S)-3-ethyloctane-1,8-diol is CC[C@H](CCO)CCCCCO.
What is the InChIKey of (3S)-3-ethyloctane-1,8-diol?
The InChIKey is SEGKJLWPIPSYSC-JTQLQIEISA-N. The full InChI is InChI=1S/C10H22O2/c1-2-10(7-9-12)6-4-3-5-8-11/h10-12H,2-9H2,1H3/t10-/m0/s1.
What are the key properties of (3S)-3-ethyloctane-1,8-diol?
(3S)-3-ethyloctane-1,8-diol has a molecular weight of 174.28 g/mol, XLogP of 1.95, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-ethyloctane-1,8-diol is sourced from PubChem (CID 118889766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).