About azane;3-ethylhenicosan-1-ol
azane;3-ethylhenicosan-1-ol (PubChem CID 174815540) has the molecular formula C23H51NO
and a molecular weight of 357.67 g/mol. Its IUPAC name is azane;3-ethylhenicosan-1-ol.
Molecular Properties
| Compound Name | azane;3-ethylhenicosan-1-ol |
| PubChem CID | 174815540 |
| Molecular Formula | C23H51NO |
| Molecular Weight | 357.67 g/mol |
| Exact Mass | 357.40 |
| IUPAC Name | azane;3-ethylhenicosan-1-ol |
| SMILES | CCCCCCCCCCCCCCCCCCC(CC)CCO.N |
| InChI | InChI=1S/C23H48O.H3N/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(4-2)21-22-24;/h23-24H,3-22H2,1-2H3;1H3 |
| InChIKey | QOGFDSCPMLMSIA-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.67 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;3-ethylhenicosan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-ethylhenicosan-1-ol?
The IUPAC name of azane;3-ethylhenicosan-1-ol (CID 174815540) is azane;3-ethylhenicosan-1-ol.
What is the SMILES notation for azane;3-ethylhenicosan-1-ol?
The canonical SMILES for azane;3-ethylhenicosan-1-ol is CCCCCCCCCCCCCCCCCCC(CC)CCO.N.
What is the InChIKey of azane;3-ethylhenicosan-1-ol?
The InChIKey is QOGFDSCPMLMSIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H48O.H3N/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(4-2)21-22-24;/h23-24H,3-22H2,1-2H3;1H3.
What are the key properties of azane;3-ethylhenicosan-1-ol?
azane;3-ethylhenicosan-1-ol has a molecular weight of 357.67 g/mol, XLogP of 8.21, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-ethylhenicosan-1-ol is sourced from PubChem (CID 174815540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).