About (2R)-2-heptylbutane-1,4-diol
(2R)-2-heptylbutane-1,4-diol (PubChem CID 129405629) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is (2R)-2-heptylbutane-1,4-diol.
Molecular Properties
| Compound Name | (2R)-2-heptylbutane-1,4-diol |
| PubChem CID | 129405629 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | (2R)-2-heptylbutane-1,4-diol |
| SMILES | CCCCCCC[C@@H](CO)CCO |
| InChI | InChI=1S/C11H24O2/c1-2-3-4-5-6-7-11(10-13)8-9-12/h11-13H,2-10H2,1H3/t11-/m1/s1 |
| InChIKey | UWIHDVYPIGJDKC-LLVKDONJSA-N |
| XLogP | 2.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-heptylbutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-heptylbutane-1,4-diol?
The IUPAC name of (2R)-2-heptylbutane-1,4-diol (CID 129405629) is (2R)-2-heptylbutane-1,4-diol.
What is the SMILES notation for (2R)-2-heptylbutane-1,4-diol?
The canonical SMILES for (2R)-2-heptylbutane-1,4-diol is CCCCCCC[C@@H](CO)CCO.
What is the InChIKey of (2R)-2-heptylbutane-1,4-diol?
The InChIKey is UWIHDVYPIGJDKC-LLVKDONJSA-N. The full InChI is InChI=1S/C11H24O2/c1-2-3-4-5-6-7-11(10-13)8-9-12/h11-13H,2-10H2,1H3/t11-/m1/s1.
What are the key properties of (2R)-2-heptylbutane-1,4-diol?
(2R)-2-heptylbutane-1,4-diol has a molecular weight of 188.31 g/mol, XLogP of 2.34, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-heptylbutane-1,4-diol is sourced from PubChem (CID 129405629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).