About (2S)-2-octylbutane-1,4-diol
(2S)-2-octylbutane-1,4-diol (PubChem CID 71417147) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is (2S)-2-octylbutane-1,4-diol.
Molecular Properties
| Compound Name | (2S)-2-octylbutane-1,4-diol |
| PubChem CID | 71417147 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | (2S)-2-octylbutane-1,4-diol |
| SMILES | CCCCCCCC[C@H](CO)CCO |
| InChI | InChI=1S/C12H26O2/c1-2-3-4-5-6-7-8-12(11-14)9-10-13/h12-14H,2-11H2,1H3/t12-/m0/s1 |
| InChIKey | TYBKGVWQUWPGQF-LBPRGKRZSA-N |
| XLogP | 2.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-octylbutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-octylbutane-1,4-diol?
The IUPAC name of (2S)-2-octylbutane-1,4-diol (CID 71417147) is (2S)-2-octylbutane-1,4-diol.
What is the SMILES notation for (2S)-2-octylbutane-1,4-diol?
The canonical SMILES for (2S)-2-octylbutane-1,4-diol is CCCCCCCC[C@H](CO)CCO.
What is the InChIKey of (2S)-2-octylbutane-1,4-diol?
The InChIKey is TYBKGVWQUWPGQF-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H26O2/c1-2-3-4-5-6-7-8-12(11-14)9-10-13/h12-14H,2-11H2,1H3/t12-/m0/s1.
What are the key properties of (2S)-2-octylbutane-1,4-diol?
(2S)-2-octylbutane-1,4-diol has a molecular weight of 202.34 g/mol, XLogP of 2.73, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-octylbutane-1,4-diol is sourced from PubChem (CID 71417147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).