About 3-pentylundecan-1-ol
3-pentylundecan-1-ol (PubChem CID 118576679) has the molecular formula C16H34O
and a molecular weight of 242.45 g/mol. Its IUPAC name is 3-pentylundecan-1-ol.
Molecular Properties
| Compound Name | 3-pentylundecan-1-ol |
| PubChem CID | 118576679 |
| Molecular Formula | C16H34O |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.26 |
| IUPAC Name | 3-pentylundecan-1-ol |
| SMILES | CCCCCCCCC(CCO)CCCCC |
| InChI | InChI=1S/C16H34O/c1-3-5-7-8-9-11-13-16(14-15-17)12-10-6-4-2/h16-17H,3-15H2,1-2H3 |
| InChIKey | GPFWOZMPTNZGGW-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentylundecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentylundecan-1-ol?
The IUPAC name of 3-pentylundecan-1-ol (CID 118576679) is 3-pentylundecan-1-ol.
What is the SMILES notation for 3-pentylundecan-1-ol?
The canonical SMILES for 3-pentylundecan-1-ol is CCCCCCCCC(CCO)CCCCC.
What is the InChIKey of 3-pentylundecan-1-ol?
The InChIKey is GPFWOZMPTNZGGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O/c1-3-5-7-8-9-11-13-16(14-15-17)12-10-6-4-2/h16-17H,3-15H2,1-2H3.
What are the key properties of 3-pentylundecan-1-ol?
3-pentylundecan-1-ol has a molecular weight of 242.45 g/mol, XLogP of 5.32, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentylundecan-1-ol is sourced from PubChem (CID 118576679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).