About 2-(2-pentyloctyl)butane-1,4-diol
2-(2-pentyloctyl)butane-1,4-diol (PubChem CID 174851829) has the molecular formula C17H36O2
and a molecular weight of 272.47 g/mol. Its IUPAC name is 2-(2-pentyloctyl)butane-1,4-diol.
Molecular Properties
| Compound Name | 2-(2-pentyloctyl)butane-1,4-diol |
| PubChem CID | 174851829 |
| Molecular Formula | C17H36O2 |
| Molecular Weight | 272.47 g/mol |
| Exact Mass | 272.27 |
| IUPAC Name | 2-(2-pentyloctyl)butane-1,4-diol |
| SMILES | CCCCCCC(CCCCC)CC(CO)CCO |
| InChI | InChI=1S/C17H36O2/c1-3-5-7-9-11-16(10-8-6-4-2)14-17(15-19)12-13-18/h16-19H,3-15H2,1-2H3 |
| InChIKey | OFDNIOVRNXBNOH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-pentyloctyl)butane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-pentyloctyl)butane-1,4-diol?
The IUPAC name of 2-(2-pentyloctyl)butane-1,4-diol (CID 174851829) is 2-(2-pentyloctyl)butane-1,4-diol.
What is the SMILES notation for 2-(2-pentyloctyl)butane-1,4-diol?
The canonical SMILES for 2-(2-pentyloctyl)butane-1,4-diol is CCCCCCC(CCCCC)CC(CO)CCO.
What is the InChIKey of 2-(2-pentyloctyl)butane-1,4-diol?
The InChIKey is OFDNIOVRNXBNOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O2/c1-3-5-7-9-11-16(10-8-6-4-2)14-17(15-19)12-13-18/h16-19H,3-15H2,1-2H3.
What are the key properties of 2-(2-pentyloctyl)butane-1,4-diol?
2-(2-pentyloctyl)butane-1,4-diol has a molecular weight of 272.47 g/mol, XLogP of 4.53, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-pentyloctyl)butane-1,4-diol is sourced from PubChem (CID 174851829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).