About 2-pentyltridecan-1-ol
2-pentyltridecan-1-ol (PubChem CID 19896300) has the molecular formula C18H38O
and a molecular weight of 270.50 g/mol. Its IUPAC name is 2-pentyltridecan-1-ol.
Molecular Properties
| Compound Name | 2-pentyltridecan-1-ol |
| PubChem CID | 19896300 |
| Molecular Formula | C18H38O |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.29 |
| IUPAC Name | 2-pentyltridecan-1-ol |
| SMILES | CCCCCCCCCCCC(CO)CCCCC |
| InChI | InChI=1S/C18H38O/c1-3-5-7-8-9-10-11-12-14-16-18(17-19)15-13-6-4-2/h18-19H,3-17H2,1-2H3 |
| InChIKey | WHIYIPYWVGGYBB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyltridecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyltridecan-1-ol?
The IUPAC name of 2-pentyltridecan-1-ol (CID 19896300) is 2-pentyltridecan-1-ol.
What is the SMILES notation for 2-pentyltridecan-1-ol?
The canonical SMILES for 2-pentyltridecan-1-ol is CCCCCCCCCCCC(CO)CCCCC.
What is the InChIKey of 2-pentyltridecan-1-ol?
The InChIKey is WHIYIPYWVGGYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O/c1-3-5-7-8-9-10-11-12-14-16-18(17-19)15-13-6-4-2/h18-19H,3-17H2,1-2H3.
What are the key properties of 2-pentyltridecan-1-ol?
2-pentyltridecan-1-ol has a molecular weight of 270.50 g/mol, XLogP of 6.10, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyltridecan-1-ol is sourced from PubChem (CID 19896300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).