About ethanol;2-heptylnonan-1-ol
ethanol;2-heptylnonan-1-ol (PubChem CID 122482877) has the molecular formula C20H46O3
and a molecular weight of 334.59 g/mol. Its IUPAC name is ethanol;2-heptylnonan-1-ol.
Molecular Properties
| Compound Name | ethanol;2-heptylnonan-1-ol |
| PubChem CID | 122482877 |
| Molecular Formula | C20H46O3 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.34 |
| IUPAC Name | ethanol;2-heptylnonan-1-ol |
| SMILES | CCCCCCCC(CO)CCCCCCC.CCO.CCO |
| InChI | InChI=1S/C16H34O.2C2H6O/c1-3-5-7-9-11-13-16(15-17)14-12-10-8-6-4-2;2*1-2-3/h16-17H,3-15H2,1-2H3;2*3H,2H2,1H3 |
| InChIKey | OFGKNIOZRPGFII-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-heptylnonan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-heptylnonan-1-ol?
The IUPAC name of ethanol;2-heptylnonan-1-ol (CID 122482877) is ethanol;2-heptylnonan-1-ol.
What is the SMILES notation for ethanol;2-heptylnonan-1-ol?
The canonical SMILES for ethanol;2-heptylnonan-1-ol is CCCCCCCC(CO)CCCCCCC.CCO.CCO.
What is the InChIKey of ethanol;2-heptylnonan-1-ol?
The InChIKey is OFGKNIOZRPGFII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O.2C2H6O/c1-3-5-7-9-11-13-16(15-17)14-12-10-8-6-4-2;2*1-2-3/h16-17H,3-15H2,1-2H3;2*3H,2H2,1H3.
What are the key properties of ethanol;2-heptylnonan-1-ol?
ethanol;2-heptylnonan-1-ol has a molecular weight of 334.59 g/mol, XLogP of 5.31, 13 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-heptylnonan-1-ol is sourced from PubChem (CID 122482877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).