About 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol
8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol (PubChem CID 170925289) has the molecular formula C16H34O3
and a molecular weight of 274.44 g/mol. Its IUPAC name is 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol.
Molecular Properties
| Compound Name | 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol |
| PubChem CID | 170925289 |
| Molecular Formula | C16H34O3 |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.25 |
| IUPAC Name | 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol |
| SMILES | CCC(CCCCO)CCCC(CCO)CCCO |
| InChI | InChI=1S/C16H34O3/c1-2-15(7-3-4-12-17)8-5-9-16(11-14-19)10-6-13-18/h15-19H,2-14H2,1H3 |
| InChIKey | OFAIMIWZDDBZNJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol?
The IUPAC name of 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol (CID 170925289) is 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol.
What is the SMILES notation for 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol?
The canonical SMILES for 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol is CCC(CCCCO)CCCC(CCO)CCCO.
What is the InChIKey of 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol?
The InChIKey is OFAIMIWZDDBZNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O3/c1-2-15(7-3-4-12-17)8-5-9-16(11-14-19)10-6-13-18/h15-19H,2-14H2,1H3.
What are the key properties of 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol?
8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol has a molecular weight of 274.44 g/mol, XLogP of 3.12, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-4-(2-hydroxyethyl)dodecane-1,12-diol is sourced from PubChem (CID 170925289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).