C13H28O2 — CID 19787583
3,6-diethylnonane-1,9-diol (PubChem CID 19787583) has the molecular formula C13H28O2 and a molecular weight of 216.36 g/mol. Its IUPAC name is 3,6-diethylnonane-1,9-diol.
| Compound Name | 3,6-diethylnonane-1,9-diol |
|---|---|
| PubChem CID | 19787583 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | 3,6-diethylnonane-1,9-diol |
| SMILES | CCC(CCO)CCC(CC)CCCO |
| InChI | InChI=1S/C13H28O2/c1-3-12(6-5-10-14)7-8-13(4-2)9-11-15/h12-15H,3-11H2,1-2H3 |
| InChIKey | ZAEBYRWKPCXZGV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |