About 6-(hydroxymethyl)octyl acetate
6-(hydroxymethyl)octyl acetate (PubChem CID 175369480) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 6-(hydroxymethyl)octyl acetate.
Molecular Properties
| Compound Name | 6-(hydroxymethyl)octyl acetate |
| PubChem CID | 175369480 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 6-(hydroxymethyl)octyl acetate |
| SMILES | CCC(CO)CCCCCOC(C)=O |
| InChI | InChI=1S/C11H22O3/c1-3-11(9-12)7-5-4-6-8-14-10(2)13/h11-12H,3-9H2,1-2H3 |
| InChIKey | QBICOCIVLHQISW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(hydroxymethyl)octyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxymethyl)octyl acetate?
The IUPAC name of 6-(hydroxymethyl)octyl acetate (CID 175369480) is 6-(hydroxymethyl)octyl acetate.
What is the SMILES notation for 6-(hydroxymethyl)octyl acetate?
The canonical SMILES for 6-(hydroxymethyl)octyl acetate is CCC(CO)CCCCCOC(C)=O.
What is the InChIKey of 6-(hydroxymethyl)octyl acetate?
The InChIKey is QBICOCIVLHQISW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-3-11(9-12)7-5-4-6-8-14-10(2)13/h11-12H,3-9H2,1-2H3.
What are the key properties of 6-(hydroxymethyl)octyl acetate?
6-(hydroxymethyl)octyl acetate has a molecular weight of 202.29 g/mol, XLogP of 2.13, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxymethyl)octyl acetate is sourced from PubChem (CID 175369480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).