About 5-chloroheptyl acetate
5-chloroheptyl acetate (PubChem CID 527863) has the molecular formula C9H17ClO2
and a molecular weight of 192.69 g/mol. Its IUPAC name is 5-chloroheptyl acetate.
Molecular Properties
| Compound Name | 5-chloroheptyl acetate |
| PubChem CID | 527863 |
| Molecular Formula | C9H17ClO2 |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 5-chloroheptyl acetate |
| SMILES | CCC(Cl)CCCCOC(C)=O |
| InChI | InChI=1S/C9H17ClO2/c1-3-9(10)6-4-5-7-12-8(2)11/h9H,3-7H2,1-2H3 |
| InChIKey | YVOMDINZHHPERG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloroheptyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloroheptyl acetate?
The IUPAC name of 5-chloroheptyl acetate (CID 527863) is 5-chloroheptyl acetate.
What is the SMILES notation for 5-chloroheptyl acetate?
The canonical SMILES for 5-chloroheptyl acetate is CCC(Cl)CCCCOC(C)=O.
What is the InChIKey of 5-chloroheptyl acetate?
The InChIKey is YVOMDINZHHPERG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17ClO2/c1-3-9(10)6-4-5-7-12-8(2)11/h9H,3-7H2,1-2H3.
What are the key properties of 5-chloroheptyl acetate?
5-chloroheptyl acetate has a molecular weight of 192.69 g/mol, XLogP of 2.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloroheptyl acetate is sourced from PubChem (CID 527863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).