About 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate
7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate (PubChem CID 146451348) has the molecular formula C17H30Cl2O4
and a molecular weight of 369.33 g/mol. Its IUPAC name is 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate.
Molecular Properties
| Compound Name | 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate |
| PubChem CID | 146451348 |
| Molecular Formula | C17H30Cl2O4 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate |
| SMILES | CCC(Cl)CC(=O)OCCCCCCCOC(=O)CC(Cl)CC |
| InChI | InChI=1S/C17H30Cl2O4/c1-3-14(18)12-16(20)22-10-8-6-5-7-9-11-23-17(21)13-15(19)4-2/h14-15H,3-13H2,1-2H3 |
| InChIKey | DKKLZPRDSGYFMM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate?
The IUPAC name of 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate (CID 146451348) is 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate.
What is the SMILES notation for 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate?
The canonical SMILES for 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate is CCC(Cl)CC(=O)OCCCCCCCOC(=O)CC(Cl)CC.
What is the InChIKey of 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate?
The InChIKey is DKKLZPRDSGYFMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30Cl2O4/c1-3-14(18)12-16(20)22-10-8-6-5-7-9-11-23-17(21)13-15(19)4-2/h14-15H,3-13H2,1-2H3.
What are the key properties of 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate?
7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate has a molecular weight of 369.33 g/mol, XLogP of 4.84, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-chloropentanoyloxy)heptyl 3-chloropentanoate is sourced from PubChem (CID 146451348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).