About [(8S)-8-methyldecyl] acetate
[(8S)-8-methyldecyl] acetate (PubChem CID 139653084) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is [(8S)-8-methyldecyl] acetate.
Molecular Properties
| Compound Name | [(8S)-8-methyldecyl] acetate |
| PubChem CID | 139653084 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | [(8S)-8-methyldecyl] acetate |
| SMILES | CC[C@H](C)CCCCCCCOC(C)=O |
| InChI | InChI=1S/C13H26O2/c1-4-12(2)10-8-6-5-7-9-11-15-13(3)14/h12H,4-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | WFMBYSLAXZIZRG-LBPRGKRZSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(8S)-8-methyldecyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(8S)-8-methyldecyl] acetate?
The IUPAC name of [(8S)-8-methyldecyl] acetate (CID 139653084) is [(8S)-8-methyldecyl] acetate.
What is the SMILES notation for [(8S)-8-methyldecyl] acetate?
The canonical SMILES for [(8S)-8-methyldecyl] acetate is CC[C@H](C)CCCCCCCOC(C)=O.
What is the InChIKey of [(8S)-8-methyldecyl] acetate?
The InChIKey is WFMBYSLAXZIZRG-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H26O2/c1-4-12(2)10-8-6-5-7-9-11-15-13(3)14/h12H,4-11H2,1-3H3/t12-/m0/s1.
What are the key properties of [(8S)-8-methyldecyl] acetate?
[(8S)-8-methyldecyl] acetate has a molecular weight of 214.35 g/mol, XLogP of 3.94, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(8S)-8-methyldecyl] acetate is sourced from PubChem (CID 139653084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).