About 6-methylheptyl acetate
6-methylheptyl acetate (PubChem CID 175958030) has the molecular formula C20H40O4
and a molecular weight of 344.54 g/mol. Its IUPAC name is 6-methylheptyl acetate.
Molecular Properties
| Compound Name | 6-methylheptyl acetate |
| PubChem CID | 175958030 |
| Molecular Formula | C20H40O4 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | 6-methylheptyl acetate |
| SMILES | CC(=O)OCCCCCC(C)C.CC(=O)OCCCCCC(C)C |
| InChI | InChI=1S/2C10H20O2/c2*1-9(2)7-5-4-6-8-12-10(3)11/h2*9H,4-8H2,1-3H3 |
| InChIKey | UYJYHRYWKVWYED-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methylheptyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptyl acetate?
The IUPAC name of 6-methylheptyl acetate (CID 175958030) is 6-methylheptyl acetate.
What is the SMILES notation for 6-methylheptyl acetate?
The canonical SMILES for 6-methylheptyl acetate is CC(=O)OCCCCCC(C)C.CC(=O)OCCCCCC(C)C.
What is the InChIKey of 6-methylheptyl acetate?
The InChIKey is UYJYHRYWKVWYED-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H20O2/c2*1-9(2)7-5-4-6-8-12-10(3)11/h2*9H,4-8H2,1-3H3.
What are the key properties of 6-methylheptyl acetate?
6-methylheptyl acetate has a molecular weight of 344.54 g/mol, XLogP of 5.53, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptyl acetate is sourced from PubChem (CID 175958030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).