About 16-methylheptadecyl carbamate
16-methylheptadecyl carbamate (PubChem CID 175072884) has the molecular formula C19H39NO2
and a molecular weight of 313.53 g/mol. Its IUPAC name is 16-methylheptadecyl carbamate.
Molecular Properties
| Compound Name | 16-methylheptadecyl carbamate |
| PubChem CID | 175072884 |
| Molecular Formula | C19H39NO2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.30 |
| IUPAC Name | 16-methylheptadecyl carbamate |
| SMILES | CC(C)CCCCCCCCCCCCCCCOC(N)=O |
| InChI | InChI=1S/C19H39NO2/c1-18(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-22-19(20)21/h18H,3-17H2,1-2H3,(H2,20,21) |
| InChIKey | NPMKHZNQPKQVJR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 16-methylheptadecyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16-methylheptadecyl carbamate?
The IUPAC name of 16-methylheptadecyl carbamate (CID 175072884) is 16-methylheptadecyl carbamate.
What is the SMILES notation for 16-methylheptadecyl carbamate?
The canonical SMILES for 16-methylheptadecyl carbamate is CC(C)CCCCCCCCCCCCCCCOC(N)=O.
What is the InChIKey of 16-methylheptadecyl carbamate?
The InChIKey is NPMKHZNQPKQVJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NO2/c1-18(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-22-19(20)21/h18H,3-17H2,1-2H3,(H2,20,21).
What are the key properties of 16-methylheptadecyl carbamate?
16-methylheptadecyl carbamate has a molecular weight of 313.53 g/mol, XLogP of 6.20, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 16-methylheptadecyl carbamate is sourced from PubChem (CID 175072884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).