About 9-carbamoyloxynonyl carbamate
9-carbamoyloxynonyl carbamate (PubChem CID 87883969) has the molecular formula C11H22N2O4
and a molecular weight of 246.31 g/mol. Its IUPAC name is 9-carbamoyloxynonyl carbamate.
Molecular Properties
| Compound Name | 9-carbamoyloxynonyl carbamate |
| PubChem CID | 87883969 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 9-carbamoyloxynonyl carbamate |
| SMILES | NC(=O)OCCCCCCCCCOC(N)=O |
| InChI | InChI=1S/C11H22N2O4/c12-10(14)16-8-6-4-2-1-3-5-7-9-17-11(13)15/h1-9H2,(H2,12,14)(H2,13,15) |
| InChIKey | BHEDRMHDQNNWMZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-carbamoyloxynonyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-carbamoyloxynonyl carbamate?
The IUPAC name of 9-carbamoyloxynonyl carbamate (CID 87883969) is 9-carbamoyloxynonyl carbamate.
What is the SMILES notation for 9-carbamoyloxynonyl carbamate?
The canonical SMILES for 9-carbamoyloxynonyl carbamate is NC(=O)OCCCCCCCCCOC(N)=O.
What is the InChIKey of 9-carbamoyloxynonyl carbamate?
The InChIKey is BHEDRMHDQNNWMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O4/c12-10(14)16-8-6-4-2-1-3-5-7-9-17-11(13)15/h1-9H2,(H2,12,14)(H2,13,15).
What are the key properties of 9-carbamoyloxynonyl carbamate?
9-carbamoyloxynonyl carbamate has a molecular weight of 246.31 g/mol, XLogP of 1.91, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-carbamoyloxynonyl carbamate is sourced from PubChem (CID 87883969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).