About 6-bromohexyl carbamate
6-bromohexyl carbamate (PubChem CID 174934401) has the molecular formula C7H14BrNO2
and a molecular weight of 224.10 g/mol. Its IUPAC name is 6-bromohexyl carbamate.
Molecular Properties
| Compound Name | 6-bromohexyl carbamate |
| PubChem CID | 174934401 |
| Molecular Formula | C7H14BrNO2 |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 6-bromohexyl carbamate |
| SMILES | NC(=O)OCCCCCCBr |
| InChI | InChI=1S/C7H14BrNO2/c8-5-3-1-2-4-6-11-7(9)10/h1-6H2,(H2,9,10) |
| InChIKey | QMUQKAKLZMLMSA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromohexyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromohexyl carbamate?
The IUPAC name of 6-bromohexyl carbamate (CID 174934401) is 6-bromohexyl carbamate.
What is the SMILES notation for 6-bromohexyl carbamate?
The canonical SMILES for 6-bromohexyl carbamate is NC(=O)OCCCCCCBr.
What is the InChIKey of 6-bromohexyl carbamate?
The InChIKey is QMUQKAKLZMLMSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BrNO2/c8-5-3-1-2-4-6-11-7(9)10/h1-6H2,(H2,9,10).
What are the key properties of 6-bromohexyl carbamate?
6-bromohexyl carbamate has a molecular weight of 224.10 g/mol, XLogP of 2.04, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromohexyl carbamate is sourced from PubChem (CID 174934401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).