About 9-hydroxynonyl 8-bromooctanoate
9-hydroxynonyl 8-bromooctanoate (PubChem CID 71420603) has the molecular formula C17H33BrO3
and a molecular weight of 365.35 g/mol. Its IUPAC name is 9-hydroxynonyl 8-bromooctanoate.
Molecular Properties
| Compound Name | 9-hydroxynonyl 8-bromooctanoate |
| PubChem CID | 71420603 |
| Molecular Formula | C17H33BrO3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 9-hydroxynonyl 8-bromooctanoate |
| SMILES | O=C(CCCCCCCBr)OCCCCCCCCCO |
| InChI | InChI=1S/C17H33BrO3/c18-14-10-6-4-5-9-13-17(20)21-16-12-8-3-1-2-7-11-15-19/h19H,1-16H2 |
| InChIKey | SAAHRTLNNFNKCL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxynonyl 8-bromooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxynonyl 8-bromooctanoate?
The IUPAC name of 9-hydroxynonyl 8-bromooctanoate (CID 71420603) is 9-hydroxynonyl 8-bromooctanoate.
What is the SMILES notation for 9-hydroxynonyl 8-bromooctanoate?
The canonical SMILES for 9-hydroxynonyl 8-bromooctanoate is O=C(CCCCCCCBr)OCCCCCCCCCO.
What is the InChIKey of 9-hydroxynonyl 8-bromooctanoate?
The InChIKey is SAAHRTLNNFNKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33BrO3/c18-14-10-6-4-5-9-13-17(20)21-16-12-8-3-1-2-7-11-15-19/h19H,1-16H2.
What are the key properties of 9-hydroxynonyl 8-bromooctanoate?
9-hydroxynonyl 8-bromooctanoate has a molecular weight of 365.35 g/mol, XLogP of 4.99, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxynonyl 8-bromooctanoate is sourced from PubChem (CID 71420603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).