C60H102O21 — CID 88979293
6-[6-[6-[6-[6-[6-[6-[6-[6-(6-hydroxyhexanoyloxy)hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoic acid (PubChem CID 88979293) has the molecular formula C60H102O21 and a molecular weight of 1159.45 g/mol. Its IUPAC name is 6-[6-[6-[6-[6-[6-[6-[6-[6-(6-hydroxyhexanoyloxy)hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoic acid.
| Compound Name | 6-[6-[6-[6-[6-[6-[6-[6-[6-(6-hydroxyhexanoyloxy)hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoic acid |
|---|---|
| PubChem CID | 88979293 |
| Molecular Formula | C60H102O21 |
| Molecular Weight | 1159.45 g/mol |
| Exact Mass | 1158.69 |
| IUPAC Name | 6-[6-[6-[6-[6-[6-[6-[6-[6-(6-hydroxyhexanoyloxy)hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoyloxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOC(=O)CCCCCOC(=O)CCCCCOC(=O)CCCCCOC(=O)CCCCCOC(=O)CCCCCOC(=O)CCCCCOC(=O)CCCCCOC(=O)CCCCCOC(=O)CCCCCO |
| InChI | InChI=1S/C60H102O21/c61-41-21-1-12-32-52(64)74-43-23-3-14-34-54(66)76-45-25-5-16-36-56(68)78-47-27-7-18-38-58(70)80-49-29-9-20-40-60(72)81-50-30-10-19-39-59(71)79-48-28-8-17-37-57(69)77-46-26-6-15-35-55(67)75-44-24-4-13-33-53(65)73-42-22-2-11-31-51(62)63/h61H,1-50H2,(H,62,63) |
| InChIKey | XWWNJFMOFJRAOQ-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 294.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 59 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1159.45 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|