C18H32O10 — CID 87078345
6-[4-(5-carboxypentanoyloxy)butoxy]-6-oxohexanoic acid;ethane-1,2-diol (PubChem CID 87078345) has the molecular formula C18H32O10 and a molecular weight of 408.44 g/mol. Its IUPAC name is 6-[4-(5-carboxypentanoyloxy)butoxy]-6-oxohexanoic acid;ethane-1,2-diol.
| Compound Name | 6-[4-(5-carboxypentanoyloxy)butoxy]-6-oxohexanoic acid;ethane-1,2-diol |
|---|---|
| PubChem CID | 87078345 |
| Molecular Formula | C18H32O10 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 6-[4-(5-carboxypentanoyloxy)butoxy]-6-oxohexanoic acid;ethane-1,2-diol |
| SMILES | O=C(O)CCCCC(=O)OCCCCOC(=O)CCCCC(=O)O.OCCO |
| InChI | InChI=1S/C16H26O8.C2H6O2/c17-13(18)7-1-3-9-15(21)23-11-5-6-12-24-16(22)10-4-2-8-14(19)20;3-1-2-4/h1-12H2,(H,17,18)(H,19,20);3-4H,1-2H2 |
| InChIKey | OAVSSKFVLYKVFM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|