C30H46O16 — CID 101096929
6-[4-[4-[4-[4-[4-(3-carboxypropanoyloxy)butoxy]-4-oxobutanoyl]oxybutoxy]-4-oxobutanoyl]oxybutoxy]-6-oxohexanoic acid (PubChem CID 101096929) has the molecular formula C30H46O16 and a molecular weight of 662.68 g/mol. Its IUPAC name is 6-[4-[4-[4-[4-[4-(3-carboxypropanoyloxy)butoxy]-4-oxobutanoyl]oxybutoxy]-4-oxobutanoyl]oxybutoxy]-6-oxohexanoic acid.
| Compound Name | 6-[4-[4-[4-[4-[4-(3-carboxypropanoyloxy)butoxy]-4-oxobutanoyl]oxybutoxy]-4-oxobutanoyl]oxybutoxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 101096929 |
| Molecular Formula | C30H46O16 |
| Molecular Weight | 662.68 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | 6-[4-[4-[4-[4-[4-(3-carboxypropanoyloxy)butoxy]-4-oxobutanoyl]oxybutoxy]-4-oxobutanoyl]oxybutoxy]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)OCCCCOC(=O)CCC(=O)OCCCCOC(=O)CCC(=O)OCCCCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C30H46O16/c31-23(32)9-1-2-10-25(35)41-17-3-4-19-43-27(37)13-14-29(39)45-21-7-8-22-46-30(40)16-15-28(38)44-20-6-5-18-42-26(36)12-11-24(33)34/h1-22H2,(H,31,32)(H,33,34) |
| InChIKey | OLVJPIGTGLHYND-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 232.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.68 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|