C30H54O16 — CID 174534613
bis(bis(4-hydroxybutyl) butanedioate);hexanedioic acid (PubChem CID 174534613) has the molecular formula C30H54O16 and a molecular weight of 670.75 g/mol. Its IUPAC name is bis(bis(4-hydroxybutyl) butanedioate);hexanedioic acid.
| Compound Name | bis(bis(4-hydroxybutyl) butanedioate);hexanedioic acid |
|---|---|
| PubChem CID | 174534613 |
| Molecular Formula | C30H54O16 |
| Molecular Weight | 670.75 g/mol |
| Exact Mass | 670.34 |
| IUPAC Name | bis(bis(4-hydroxybutyl) butanedioate);hexanedioic acid |
| SMILES | O=C(CCC(=O)OCCCCO)OCCCCO.O=C(CCC(=O)OCCCCO)OCCCCO.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/2C12H22O6.C6H10O4/c2*13-7-1-3-9-17-11(15)5-6-12(16)18-10-4-2-8-14;7-5(8)3-1-2-4-6(9)10/h2*13-14H,1-10H2;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | SDKDXSTWOKVGOO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 260.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.75 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|