C14H28O7 — CID 87123027
ethane-1,2-diol;ethene;6-(4-hydroxybutoxy)-6-oxohexanoic acid (PubChem CID 87123027) has the molecular formula C14H28O7 and a molecular weight of 308.37 g/mol. Its IUPAC name is ethane-1,2-diol;ethene;6-(4-hydroxybutoxy)-6-oxohexanoic acid.
| Compound Name | ethane-1,2-diol;ethene;6-(4-hydroxybutoxy)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 87123027 |
| Molecular Formula | C14H28O7 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | ethane-1,2-diol;ethene;6-(4-hydroxybutoxy)-6-oxohexanoic acid |
| SMILES | C=C.O=C(O)CCCCC(=O)OCCCCO.OCCO |
| InChI | InChI=1S/C10H18O5.C2H6O2.C2H4/c11-7-3-4-8-15-10(14)6-2-1-5-9(12)13;3-1-2-4;1-2/h11H,1-8H2,(H,12,13);3-4H,1-2H2;1-2H2 |
| InChIKey | MYYFBRWPADIXIG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|