About 10-bromodecyl 8-bromooctanoate
10-bromodecyl 8-bromooctanoate (PubChem CID 71420607) has the molecular formula C18H34Br2O2
and a molecular weight of 442.28 g/mol. Its IUPAC name is 10-bromodecyl 8-bromooctanoate.
Molecular Properties
| Compound Name | 10-bromodecyl 8-bromooctanoate |
| PubChem CID | 71420607 |
| Molecular Formula | C18H34Br2O2 |
| Molecular Weight | 442.28 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 10-bromodecyl 8-bromooctanoate |
| SMILES | O=C(CCCCCCCBr)OCCCCCCCCCCBr |
| InChI | InChI=1S/C18H34Br2O2/c19-15-11-7-3-1-2-4-9-13-17-22-18(21)14-10-6-5-8-12-16-20/h1-17H2 |
| InChIKey | LXBWKZAQEPOEMH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.28 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 10-bromodecyl 8-bromooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-bromodecyl 8-bromooctanoate?
The IUPAC name of 10-bromodecyl 8-bromooctanoate (CID 71420607) is 10-bromodecyl 8-bromooctanoate.
What is the SMILES notation for 10-bromodecyl 8-bromooctanoate?
The canonical SMILES for 10-bromodecyl 8-bromooctanoate is O=C(CCCCCCCBr)OCCCCCCCCCCBr.
What is the InChIKey of 10-bromodecyl 8-bromooctanoate?
The InChIKey is LXBWKZAQEPOEMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34Br2O2/c19-15-11-7-3-1-2-4-9-13-17-22-18(21)14-10-6-5-8-12-16-20/h1-17H2.
What are the key properties of 10-bromodecyl 8-bromooctanoate?
10-bromodecyl 8-bromooctanoate has a molecular weight of 442.28 g/mol, XLogP of 6.78, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-bromodecyl 8-bromooctanoate is sourced from PubChem (CID 71420607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).