About bis(3-bromopropyl) hexanedioate
bis(3-bromopropyl) hexanedioate (PubChem CID 11188379) has the molecular formula C12H20Br2O4
and a molecular weight of 388.10 g/mol. Its IUPAC name is bis(3-bromopropyl) hexanedioate.
Molecular Properties
| Compound Name | bis(3-bromopropyl) hexanedioate |
| PubChem CID | 11188379 |
| Molecular Formula | C12H20Br2O4 |
| Molecular Weight | 388.10 g/mol |
| Exact Mass | 385.97 |
| IUPAC Name | bis(3-bromopropyl) hexanedioate |
| SMILES | O=C(CCCCC(=O)OCCCBr)OCCCBr |
| InChI | InChI=1S/C12H20Br2O4/c13-7-3-9-17-11(15)5-1-2-6-12(16)18-10-4-8-14/h1-10H2 |
| InChIKey | DWXBZYBSSKOVIR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.10 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bis(3-bromopropyl) hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-bromopropyl) hexanedioate?
The IUPAC name of bis(3-bromopropyl) hexanedioate (CID 11188379) is bis(3-bromopropyl) hexanedioate.
What is the SMILES notation for bis(3-bromopropyl) hexanedioate?
The canonical SMILES for bis(3-bromopropyl) hexanedioate is O=C(CCCCC(=O)OCCCBr)OCCCBr.
What is the InChIKey of bis(3-bromopropyl) hexanedioate?
The InChIKey is DWXBZYBSSKOVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20Br2O4/c13-7-3-9-17-11(15)5-1-2-6-12(16)18-10-4-8-14/h1-10H2.
What are the key properties of bis(3-bromopropyl) hexanedioate?
bis(3-bromopropyl) hexanedioate has a molecular weight of 388.10 g/mol, XLogP of 3.20, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-bromopropyl) hexanedioate is sourced from PubChem (CID 11188379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).