About 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane
6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane (PubChem CID 158211085) has the molecular formula C24H58O6
and a molecular weight of 442.72 g/mol. Its IUPAC name is 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane.
Molecular Properties
| Compound Name | 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane |
| PubChem CID | 158211085 |
| Molecular Formula | C24H58O6 |
| Molecular Weight | 442.72 g/mol |
| Exact Mass | 442.42 |
| IUPAC Name | 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane |
| SMILES | C.C.C.C.C.C.O=C(CCCCCO)OCCCCCCOC(=O)CCCCCO |
| InChI | InChI=1S/C18H34O6.6CH4/c19-13-7-3-5-11-17(21)23-15-9-1-2-10-16-24-18(22)12-6-4-8-14-20;;;;;;/h19-20H,1-16H2;6*1H4 |
| InChIKey | GCBWRJFUYJRJLX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.72 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane?
The IUPAC name of 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane (CID 158211085) is 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane.
What is the SMILES notation for 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane?
The canonical SMILES for 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane is C.C.C.C.C.C.O=C(CCCCCO)OCCCCCCOC(=O)CCCCCO.
What is the InChIKey of 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane?
The InChIKey is GCBWRJFUYJRJLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O6.6CH4/c19-13-7-3-5-11-17(21)23-15-9-1-2-10-16-24-18(22)12-6-4-8-14-20;;;;;;/h19-20H,1-16H2;6*1H4.
What are the key properties of 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane?
6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane has a molecular weight of 442.72 g/mol, XLogP of 6.56, 17 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-hydroxyhexanoyloxy)hexyl 6-hydroxyhexanoate;methane is sourced from PubChem (CID 158211085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).