About 6-hydroxyhexyl octanoate
6-hydroxyhexyl octanoate (PubChem CID 23036666) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is 6-hydroxyhexyl octanoate.
Molecular Properties
| Compound Name | 6-hydroxyhexyl octanoate |
| PubChem CID | 23036666 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 6-hydroxyhexyl octanoate |
| SMILES | CCCCCCCC(=O)OCCCCCCO |
| InChI | InChI=1S/C14H28O3/c1-2-3-4-5-8-11-14(16)17-13-10-7-6-9-12-15/h15H,2-13H2,1H3 |
| InChIKey | NUFDMUXLWVEJAO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexyl octanoate?
The IUPAC name of 6-hydroxyhexyl octanoate (CID 23036666) is 6-hydroxyhexyl octanoate.
What is the SMILES notation for 6-hydroxyhexyl octanoate?
The canonical SMILES for 6-hydroxyhexyl octanoate is CCCCCCCC(=O)OCCCCCCO.
What is the InChIKey of 6-hydroxyhexyl octanoate?
The InChIKey is NUFDMUXLWVEJAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O3/c1-2-3-4-5-8-11-14(16)17-13-10-7-6-9-12-15/h15H,2-13H2,1H3.
What are the key properties of 6-hydroxyhexyl octanoate?
6-hydroxyhexyl octanoate has a molecular weight of 244.37 g/mol, XLogP of 3.44, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexyl octanoate is sourced from PubChem (CID 23036666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).