About butyl 7-hydroxyheptanoate
butyl 7-hydroxyheptanoate (PubChem CID 54028620) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is butyl 7-hydroxyheptanoate.
Molecular Properties
| Compound Name | butyl 7-hydroxyheptanoate |
| PubChem CID | 54028620 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | butyl 7-hydroxyheptanoate |
| SMILES | CCCCOC(=O)CCCCCCO |
| InChI | InChI=1S/C11H22O3/c1-2-3-10-14-11(13)8-6-4-5-7-9-12/h12H,2-10H2,1H3 |
| InChIKey | PNVJLZKYESMQPT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 7-hydroxyheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 7-hydroxyheptanoate?
The IUPAC name of butyl 7-hydroxyheptanoate (CID 54028620) is butyl 7-hydroxyheptanoate.
What is the SMILES notation for butyl 7-hydroxyheptanoate?
The canonical SMILES for butyl 7-hydroxyheptanoate is CCCCOC(=O)CCCCCCO.
What is the InChIKey of butyl 7-hydroxyheptanoate?
The InChIKey is PNVJLZKYESMQPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-2-3-10-14-11(13)8-6-4-5-7-9-12/h12H,2-10H2,1H3.
What are the key properties of butyl 7-hydroxyheptanoate?
butyl 7-hydroxyheptanoate has a molecular weight of 202.29 g/mol, XLogP of 2.27, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 7-hydroxyheptanoate is sourced from PubChem (CID 54028620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).