About 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate
1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate (PubChem CID 71420059) has the molecular formula C19H36O5
and a molecular weight of 344.49 g/mol. Its IUPAC name is 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate.
Molecular Properties
| Compound Name | 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate |
| PubChem CID | 71420059 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate |
| SMILES | CCCCCCCCCCOC(=O)CCCC(=O)OCCCCO |
| InChI | InChI=1S/C19H36O5/c1-2-3-4-5-6-7-8-10-16-23-18(21)13-12-14-19(22)24-17-11-9-15-20/h20H,2-17H2,1H3 |
| InChIKey | KYPOGIHVMMAOPA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate?
The IUPAC name of 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate (CID 71420059) is 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate.
What is the SMILES notation for 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate?
The canonical SMILES for 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate is CCCCCCCCCCOC(=O)CCCC(=O)OCCCCO.
What is the InChIKey of 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate?
The InChIKey is KYPOGIHVMMAOPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O5/c1-2-3-4-5-6-7-8-10-16-23-18(21)13-12-14-19(22)24-17-11-9-15-20/h20H,2-17H2,1H3.
What are the key properties of 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate?
1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate has a molecular weight of 344.49 g/mol, XLogP of 4.16, 17 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-decyl 5-O-(4-hydroxybutyl) pentanedioate is sourced from PubChem (CID 71420059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).