About butyl carbamate;hydroiodide
butyl carbamate;hydroiodide (PubChem CID 161347358) has the molecular formula C5H12INO2
and a molecular weight of 245.06 g/mol. Its IUPAC name is butyl carbamate;hydroiodide.
Molecular Properties
| Compound Name | butyl carbamate;hydroiodide |
| PubChem CID | 161347358 |
| Molecular Formula | C5H12INO2 |
| Molecular Weight | 245.06 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | butyl carbamate;hydroiodide |
| SMILES | CCCCOC(N)=O.I |
| InChI | InChI=1S/C5H11NO2.HI/c1-2-3-4-8-5(6)7;/h2-4H2,1H3,(H2,6,7);1H |
| InChIKey | DSFKZDADTRRFTJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.06 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze butyl carbamate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl carbamate;hydroiodide?
The IUPAC name of butyl carbamate;hydroiodide (CID 161347358) is butyl carbamate;hydroiodide.
What is the SMILES notation for butyl carbamate;hydroiodide?
The canonical SMILES for butyl carbamate;hydroiodide is CCCCOC(N)=O.I.
What is the InChIKey of butyl carbamate;hydroiodide?
The InChIKey is DSFKZDADTRRFTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.HI/c1-2-3-4-8-5(6)7;/h2-4H2,1H3,(H2,6,7);1H.
What are the key properties of butyl carbamate;hydroiodide?
butyl carbamate;hydroiodide has a molecular weight of 245.06 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl carbamate;hydroiodide is sourced from PubChem (CID 161347358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).