About butyl carbamate;prop-2-enamide
butyl carbamate;prop-2-enamide (PubChem CID 174431220) has the molecular formula C8H16N2O3
and a molecular weight of 188.23 g/mol. Its IUPAC name is butyl carbamate;prop-2-enamide.
Molecular Properties
| Compound Name | butyl carbamate;prop-2-enamide |
| PubChem CID | 174431220 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | butyl carbamate;prop-2-enamide |
| SMILES | C=CC(N)=O.CCCCOC(N)=O |
| InChI | InChI=1S/C5H11NO2.C3H5NO/c1-2-3-4-8-5(6)7;1-2-3(4)5/h2-4H2,1H3,(H2,6,7);2H,1H2,(H2,4,5) |
| InChIKey | NWYBHVZBERQWRR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butyl carbamate;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl carbamate;prop-2-enamide?
The IUPAC name of butyl carbamate;prop-2-enamide (CID 174431220) is butyl carbamate;prop-2-enamide.
What is the SMILES notation for butyl carbamate;prop-2-enamide?
The canonical SMILES for butyl carbamate;prop-2-enamide is C=CC(N)=O.CCCCOC(N)=O.
What is the InChIKey of butyl carbamate;prop-2-enamide?
The InChIKey is NWYBHVZBERQWRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C3H5NO/c1-2-3-4-8-5(6)7;1-2-3(4)5/h2-4H2,1H3,(H2,6,7);2H,1H2,(H2,4,5).
What are the key properties of butyl carbamate;prop-2-enamide?
butyl carbamate;prop-2-enamide has a molecular weight of 188.23 g/mol, XLogP of 0.54, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl carbamate;prop-2-enamide is sourced from PubChem (CID 174431220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).