About propyl carbamate;dihydrochloride
propyl carbamate;dihydrochloride (PubChem CID 87576214) has the molecular formula C4H11Cl2NO2
and a molecular weight of 176.04 g/mol. Its IUPAC name is propyl carbamate;dihydrochloride.
Molecular Properties
| Compound Name | propyl carbamate;dihydrochloride |
| PubChem CID | 87576214 |
| Molecular Formula | C4H11Cl2NO2 |
| Molecular Weight | 176.04 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | propyl carbamate;dihydrochloride |
| SMILES | CCCOC(N)=O.Cl.Cl |
| InChI | InChI=1S/C4H9NO2.2ClH/c1-2-3-7-4(5)6;;/h2-3H2,1H3,(H2,5,6);2*1H |
| InChIKey | OAVKXJWTVNSEQP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.04 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propyl carbamate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl carbamate;dihydrochloride?
The IUPAC name of propyl carbamate;dihydrochloride (CID 87576214) is propyl carbamate;dihydrochloride.
What is the SMILES notation for propyl carbamate;dihydrochloride?
The canonical SMILES for propyl carbamate;dihydrochloride is CCCOC(N)=O.Cl.Cl.
What is the InChIKey of propyl carbamate;dihydrochloride?
The InChIKey is OAVKXJWTVNSEQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.2ClH/c1-2-3-7-4(5)6;;/h2-3H2,1H3,(H2,5,6);2*1H.
What are the key properties of propyl carbamate;dihydrochloride?
propyl carbamate;dihydrochloride has a molecular weight of 176.04 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propyl carbamate;dihydrochloride is sourced from PubChem (CID 87576214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).