About 3-oxoheptyl carbamate
3-oxoheptyl carbamate (PubChem CID 151371373) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 3-oxoheptyl carbamate.
Molecular Properties
| Compound Name | 3-oxoheptyl carbamate |
| PubChem CID | 151371373 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 3-oxoheptyl carbamate |
| SMILES | CCCCC(=O)CCOC(N)=O |
| InChI | InChI=1S/C8H15NO3/c1-2-3-4-7(10)5-6-12-8(9)11/h2-6H2,1H3,(H2,9,11) |
| InChIKey | OQNBINIENAEKEK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-oxoheptyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxoheptyl carbamate?
The IUPAC name of 3-oxoheptyl carbamate (CID 151371373) is 3-oxoheptyl carbamate.
What is the SMILES notation for 3-oxoheptyl carbamate?
The canonical SMILES for 3-oxoheptyl carbamate is CCCCC(=O)CCOC(N)=O.
What is the InChIKey of 3-oxoheptyl carbamate?
The InChIKey is OQNBINIENAEKEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-2-3-4-7(10)5-6-12-8(9)11/h2-6H2,1H3,(H2,9,11).
What are the key properties of 3-oxoheptyl carbamate?
3-oxoheptyl carbamate has a molecular weight of 173.21 g/mol, XLogP of 1.23, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxoheptyl carbamate is sourced from PubChem (CID 151371373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).