About 3-oxoheptyl 2-hydroxybutanoate
3-oxoheptyl 2-hydroxybutanoate (PubChem CID 174877989) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-oxoheptyl 2-hydroxybutanoate.
Molecular Properties
| Compound Name | 3-oxoheptyl 2-hydroxybutanoate |
| PubChem CID | 174877989 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3-oxoheptyl 2-hydroxybutanoate |
| SMILES | CCCCC(=O)CCOC(=O)C(O)CC |
| InChI | InChI=1S/C11H20O4/c1-3-5-6-9(12)7-8-15-11(14)10(13)4-2/h10,13H,3-8H2,1-2H3 |
| InChIKey | RQJYDPDBJJQQKQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-oxoheptyl 2-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxoheptyl 2-hydroxybutanoate?
The IUPAC name of 3-oxoheptyl 2-hydroxybutanoate (CID 174877989) is 3-oxoheptyl 2-hydroxybutanoate.
What is the SMILES notation for 3-oxoheptyl 2-hydroxybutanoate?
The canonical SMILES for 3-oxoheptyl 2-hydroxybutanoate is CCCCC(=O)CCOC(=O)C(O)CC.
What is the InChIKey of 3-oxoheptyl 2-hydroxybutanoate?
The InChIKey is RQJYDPDBJJQQKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-3-5-6-9(12)7-8-15-11(14)10(13)4-2/h10,13H,3-8H2,1-2H3.
What are the key properties of 3-oxoheptyl 2-hydroxybutanoate?
3-oxoheptyl 2-hydroxybutanoate has a molecular weight of 216.28 g/mol, XLogP of 1.45, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxoheptyl 2-hydroxybutanoate is sourced from PubChem (CID 174877989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).