About 2-hydroxybutanoyl pentaneperoxoate
2-hydroxybutanoyl pentaneperoxoate (PubChem CID 141213946) has the molecular formula C9H16O5
and a molecular weight of 204.22 g/mol. Its IUPAC name is 2-hydroxybutanoyl pentaneperoxoate.
Molecular Properties
| Compound Name | 2-hydroxybutanoyl pentaneperoxoate |
| PubChem CID | 141213946 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-hydroxybutanoyl pentaneperoxoate |
| SMILES | CCCCC(=O)OOC(=O)C(O)CC |
| InChI | InChI=1S/C9H16O5/c1-3-5-6-8(11)13-14-9(12)7(10)4-2/h7,10H,3-6H2,1-2H3 |
| InChIKey | FDJZDXZIWZYXJP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybutanoyl pentaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanoyl pentaneperoxoate?
The IUPAC name of 2-hydroxybutanoyl pentaneperoxoate (CID 141213946) is 2-hydroxybutanoyl pentaneperoxoate.
What is the SMILES notation for 2-hydroxybutanoyl pentaneperoxoate?
The canonical SMILES for 2-hydroxybutanoyl pentaneperoxoate is CCCCC(=O)OOC(=O)C(O)CC.
What is the InChIKey of 2-hydroxybutanoyl pentaneperoxoate?
The InChIKey is FDJZDXZIWZYXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5/c1-3-5-6-8(11)13-14-9(12)7(10)4-2/h7,10H,3-6H2,1-2H3.
What are the key properties of 2-hydroxybutanoyl pentaneperoxoate?
2-hydroxybutanoyl pentaneperoxoate has a molecular weight of 204.22 g/mol, XLogP of 0.95, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanoyl pentaneperoxoate is sourced from PubChem (CID 141213946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).