About hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate
hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate (PubChem CID 141015368) has the molecular formula C14H26O5
and a molecular weight of 274.36 g/mol. Its IUPAC name is hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate.
Molecular Properties
| Compound Name | hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate |
| PubChem CID | 141015368 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate |
| SMILES | CCCCCC(=O)OOC(=O)C(CCCC)C(C)O |
| InChI | InChI=1S/C14H26O5/c1-4-6-8-10-13(16)18-19-14(17)12(11(3)15)9-7-5-2/h11-12,15H,4-10H2,1-3H3 |
| InChIKey | ABYZARWWKPMPCZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate?
The IUPAC name of hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate (CID 141015368) is hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate.
What is the SMILES notation for hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate?
The canonical SMILES for hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate is CCCCCC(=O)OOC(=O)C(CCCC)C(C)O.
What is the InChIKey of hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate?
The InChIKey is ABYZARWWKPMPCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O5/c1-4-6-8-10-13(16)18-19-14(17)12(11(3)15)9-7-5-2/h11-12,15H,4-10H2,1-3H3.
What are the key properties of hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate?
hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate has a molecular weight of 274.36 g/mol, XLogP of 2.76, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hexanoyl 2-(1-hydroxyethyl)hexaneperoxoate is sourced from PubChem (CID 141015368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).