C18H32O10 — CID 140699791
heptanoylperoxycarbonyl 2-(1,2,3-trihydroxypropyl)heptaneperoxoate (PubChem CID 140699791) has the molecular formula C18H32O10 and a molecular weight of 408.44 g/mol. Its IUPAC name is heptanoylperoxycarbonyl 2-(1,2,3-trihydroxypropyl)heptaneperoxoate.
| Compound Name | heptanoylperoxycarbonyl 2-(1,2,3-trihydroxypropyl)heptaneperoxoate |
|---|---|
| PubChem CID | 140699791 |
| Molecular Formula | C18H32O10 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | heptanoylperoxycarbonyl 2-(1,2,3-trihydroxypropyl)heptaneperoxoate |
| SMILES | CCCCCCC(=O)OOC(=O)OOC(=O)C(CCCCC)C(O)C(O)CO |
| InChI | InChI=1S/C18H32O10/c1-3-5-7-9-11-15(21)25-27-18(24)28-26-17(23)13(10-8-6-4-2)16(22)14(20)12-19/h13-14,16,19-20,22H,3-12H2,1-2H3 |
| InChIKey | ZNEWJRTWJZQSQQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|