C24H50O9 — CID 174464487
hexane-1,2,3,4,5,6-hexol;octadecaneperoxoic acid (PubChem CID 174464487) has the molecular formula C24H50O9 and a molecular weight of 482.66 g/mol. Its IUPAC name is hexane-1,2,3,4,5,6-hexol;octadecaneperoxoic acid.
| Compound Name | hexane-1,2,3,4,5,6-hexol;octadecaneperoxoic acid |
|---|---|
| PubChem CID | 174464487 |
| Molecular Formula | C24H50O9 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.35 |
| IUPAC Name | hexane-1,2,3,4,5,6-hexol;octadecaneperoxoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OO.OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C18H36O3.C6H14O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)21-20;7-1-3(9)5(11)6(12)4(10)2-8/h20H,2-17H2,1H3;3-12H,1-2H2 |
| InChIKey | HCESFTGUJASWEM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|