About lithium;hydride;octadecaneperoxoic acid
lithium;hydride;octadecaneperoxoic acid (PubChem CID 173037900) has the molecular formula C18H37LiO3
and a molecular weight of 308.43 g/mol. Its IUPAC name is lithium;hydride;octadecaneperoxoic acid.
Molecular Properties
| Compound Name | lithium;hydride;octadecaneperoxoic acid |
| PubChem CID | 173037900 |
| Molecular Formula | C18H37LiO3 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | lithium;hydride;octadecaneperoxoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OO.[H-].[Li+] |
| InChI | InChI=1S/C18H36O3.Li.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)21-20;;/h20H,2-17H2,1H3;;/q;+1;-1 |
| InChIKey | VDJDDFVBGNSQBK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;octadecaneperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;octadecaneperoxoic acid?
The IUPAC name of lithium;hydride;octadecaneperoxoic acid (CID 173037900) is lithium;hydride;octadecaneperoxoic acid.
What is the SMILES notation for lithium;hydride;octadecaneperoxoic acid?
The canonical SMILES for lithium;hydride;octadecaneperoxoic acid is CCCCCCCCCCCCCCCCCC(=O)OO.[H-].[Li+].
What is the InChIKey of lithium;hydride;octadecaneperoxoic acid?
The InChIKey is VDJDDFVBGNSQBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O3.Li.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)21-20;;/h20H,2-17H2,1H3;;/q;+1;-1.
What are the key properties of lithium;hydride;octadecaneperoxoic acid?
lithium;hydride;octadecaneperoxoic acid has a molecular weight of 308.43 g/mol, XLogP of 3.38, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;octadecaneperoxoic acid is sourced from PubChem (CID 173037900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).