About butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid
butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid (PubChem CID 175089027) has the molecular formula C15H30O9
and a molecular weight of 354.40 g/mol. Its IUPAC name is butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid.
Molecular Properties
| Compound Name | butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid |
| PubChem CID | 175089027 |
| Molecular Formula | C15H30O9 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid |
| SMILES | CCCC(=O)OO.CCCCC(=O)OO.CCCCCC(=O)OO |
| InChI | InChI=1S/C6H12O3.C5H10O3.C4H8O3/c1-2-3-4-5-6(7)9-8;1-2-3-4-5(6)8-7;1-2-3-4(5)7-6/h8H,2-5H2,1H3;7H,2-4H2,1H3;6H,2-3H2,1H3 |
| InChIKey | BYKJFSTWXMGTHC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid?
The IUPAC name of butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid (CID 175089027) is butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid.
What is the SMILES notation for butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid?
The canonical SMILES for butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid is CCCC(=O)OO.CCCCC(=O)OO.CCCCCC(=O)OO.
What is the InChIKey of butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid?
The InChIKey is BYKJFSTWXMGTHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C5H10O3.C4H8O3/c1-2-3-4-5-6(7)9-8;1-2-3-4-5(6)8-7;1-2-3-4(5)7-6/h8H,2-5H2,1H3;7H,2-4H2,1H3;6H,2-3H2,1H3.
What are the key properties of butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid?
butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid has a molecular weight of 354.40 g/mol, XLogP of 3.58, 9 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid is sourced from PubChem (CID 175089027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).