butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid

C15H30O9 — CID 175089027

IUPACbutaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid
SMILESCCCC(=O)OO.CCCCC(=O)OO.CCCCCC(=O)OO
InChIInChI=1S/C6H12O3.C5H10O3.C4H8O3/c1-2-3-4-5-6(7)9-8;1-2-3-4-5(6)8-7;1-2-3-4(5)7-6/h8H,2-5H2,1H3;7H,2-4H2,1H3;6H,2-3H2,1H3
InChIKeyBYKJFSTWXMGTHC-UHFFFAOYSA-N
MW354.40 g/mol
LogP3.58
Rot. Bonds9

About butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid

butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid (PubChem CID 175089027) has the molecular formula C15H30O9 and a molecular weight of 354.40 g/mol. Its IUPAC name is butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid.

Molecular Properties

Compound Namebutaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid
PubChem CID175089027
Molecular FormulaC15H30O9
Molecular Weight354.40 g/mol
Exact Mass354.19
IUPAC Namebutaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid
SMILESCCCC(=O)OO.CCCCC(=O)OO.CCCCCC(=O)OO
InChIInChI=1S/C6H12O3.C5H10O3.C4H8O3/c1-2-3-4-5-6(7)9-8;1-2-3-4-5(6)8-7;1-2-3-4(5)7-6/h8H,2-5H2,1H3;7H,2-4H2,1H3;6H,2-3H2,1H3
InChIKeyBYKJFSTWXMGTHC-UHFFFAOYSA-N
XLogP3.58
TPSA139.59 Ų
H-Bond Donors3
H-Bond Acceptors9
Rotatable Bonds9
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500354.40
LogP ≤ 53.58
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid?
The IUPAC name of butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid (CID 175089027) is butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid.
What is the SMILES notation for butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid?
The canonical SMILES for butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid is CCCC(=O)OO.CCCCC(=O)OO.CCCCCC(=O)OO.
What is the InChIKey of butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid?
The InChIKey is BYKJFSTWXMGTHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C5H10O3.C4H8O3/c1-2-3-4-5-6(7)9-8;1-2-3-4-5(6)8-7;1-2-3-4(5)7-6/h8H,2-5H2,1H3;7H,2-4H2,1H3;6H,2-3H2,1H3.
What are the key properties of butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid?
butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid has a molecular weight of 354.40 g/mol, XLogP of 3.58, 9 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for butaneperoxoic acid;hexaneperoxoic acid;pentaneperoxoic acid is sourced from PubChem (CID 175089027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).