C13H26O6 — CID 22216382
[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl] octanoate (PubChem CID 22216382) has the molecular formula C13H26O6 and a molecular weight of 278.34 g/mol. Its IUPAC name is [(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl] octanoate.
| Compound Name | [(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl] octanoate |
|---|---|
| PubChem CID | 22216382 |
| Molecular Formula | C13H26O6 |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | [(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl] octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H26O6/c1-2-3-4-5-6-7-12(17)19-9-11(16)13(18)10(15)8-14/h10-11,13-16,18H,2-9H2,1H3/t10-,11+,13+/m1/s1 |
| InChIKey | WATKJWBYOFPDLW-MDZLAQPJSA-N |
| XLogP | -0.03 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|