C21H40O7 — CID 155928861
[(2R,4S)-2,3,4-trihydroxy-5-octanoyloxypentyl] octanoate (PubChem CID 155928861) has the molecular formula C21H40O7 and a molecular weight of 404.54 g/mol. Its IUPAC name is [(2R,4S)-2,3,4-trihydroxy-5-octanoyloxypentyl] octanoate.
| Compound Name | [(2R,4S)-2,3,4-trihydroxy-5-octanoyloxypentyl] octanoate |
|---|---|
| PubChem CID | 155928861 |
| Molecular Formula | C21H40O7 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | [(2R,4S)-2,3,4-trihydroxy-5-octanoyloxypentyl] octanoate |
| SMILES | CCCCCCCC(=O)OC[C@@H](O)C(O)[C@@H](O)COC(=O)CCCCCCC |
| InChI | InChI=1S/C21H40O7/c1-3-5-7-9-11-13-19(24)27-15-17(22)21(26)18(23)16-28-20(25)14-12-10-8-6-4-2/h17-18,21-23,26H,3-16H2,1-2H3/t17-,18+,21? |
| InChIKey | PHQMXXUBTXHGFP-HTZLVSCSSA-N |
| XLogP | 2.88 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|