C23H44O6 — CID 90764900
[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl] octadec-9-enoate (PubChem CID 90764900) has the molecular formula C23H44O6 and a molecular weight of 416.60 g/mol. Its IUPAC name is [(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl] octadec-9-enoate.
| Compound Name | [(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl] octadec-9-enoate |
|---|---|
| PubChem CID | 90764900 |
| Molecular Formula | C23H44O6 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | [(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C23H44O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(27)29-19-21(26)23(28)20(25)18-24/h9-10,20-21,23-26,28H,2-8,11-19H2,1H3/t20-,21+,23+/m1/s1 |
| InChIKey | YGXOBAHDQXCCOR-GIWBLDEGSA-N |
| XLogP | 3.64 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|