C23H42O6 — CID 173415992
[(2R,3S,4R)-2,3,4-trihydroxy-5-oxopentyl] octadec-9-enoate (PubChem CID 173415992) has the molecular formula C23H42O6 and a molecular weight of 414.58 g/mol. Its IUPAC name is [(2R,3S,4R)-2,3,4-trihydroxy-5-oxopentyl] octadec-9-enoate.
| Compound Name | [(2R,3S,4R)-2,3,4-trihydroxy-5-oxopentyl] octadec-9-enoate |
|---|---|
| PubChem CID | 173415992 |
| Molecular Formula | C23H42O6 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | [(2R,3S,4R)-2,3,4-trihydroxy-5-oxopentyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC[C@@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C23H42O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(27)29-19-21(26)23(28)20(25)18-24/h9-10,18,20-21,23,25-26,28H,2-8,11-17,19H2,1H3/t20-,21+,23+/m0/s1 |
| InChIKey | ZUQSHALJIAWFGB-QZNHQXDQSA-N |
| XLogP | 3.85 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|