C42H78O8 — CID 54327925
[(2S,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-octadec-9-enoyloxyhexyl] octadec-9-enoate (PubChem CID 54327925) has the molecular formula C42H78O8 and a molecular weight of 711.08 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-octadec-9-enoyloxyhexyl] octadec-9-enoate.
| Compound Name | [(2S,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-octadec-9-enoyloxyhexyl] octadec-9-enoate |
|---|---|
| PubChem CID | 54327925 |
| Molecular Formula | C42H78O8 |
| Molecular Weight | 711.08 g/mol |
| Exact Mass | 710.57 |
| IUPAC Name | [(2S,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-octadec-9-enoyloxyhexyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC[C@H](OC(=O)CCCCCCCC=CCCCCCCCC)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C42H78O8/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39(45)49-36-38(42(48)41(47)37(44)35-43)50-40(46)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37-38,41-44,47-48H,3-16,21-36H2,1-2H3/t37-,38+,41-,42-/m1/s1 |
| InChIKey | SWGPJXIKPJTYBX-FOGKZQIUSA-N |
| XLogP | 9.59 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.08 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|