C24H46O8 — CID 57481111
[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] (Z)-octadec-9-enoate (PubChem CID 57481111) has the molecular formula C24H46O8 and a molecular weight of 462.62 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] (Z)-octadec-9-enoate.
| Compound Name | [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 57481111 |
| Molecular Formula | C24H46O8 |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C24H46O8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(27)32-24(31)23(30)22(29)21(28)19(26)18-25/h9-10,19,21-26,28-31H,2-8,11-18H2,1H3/b10-9-/t19-,21-,22+,23-,24?/m1/s1 |
| InChIKey | FCPGGKSALNXDTN-DJWGODSSSA-N |
| XLogP | 2.32 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|