C39H70O5 — CID 54491099
(1,2-dihydroxy-4-oxohenicosa-12,15-dien-3-yl) octadec-9-enoate (PubChem CID 54491099) has the molecular formula C39H70O5 and a molecular weight of 618.98 g/mol. Its IUPAC name is (1,2-dihydroxy-4-oxohenicosa-12,15-dien-3-yl) octadec-9-enoate.
| Compound Name | (1,2-dihydroxy-4-oxohenicosa-12,15-dien-3-yl) octadec-9-enoate |
|---|---|
| PubChem CID | 54491099 |
| Molecular Formula | C39H70O5 |
| Molecular Weight | 618.98 g/mol |
| Exact Mass | 618.52 |
| IUPAC Name | (1,2-dihydroxy-4-oxohenicosa-12,15-dien-3-yl) octadec-9-enoate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)C(OC(=O)CCCCCCCC=CCCCCCCCC)C(O)CO |
| InChI | InChI=1S/C39H70O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36(41)39(37(42)35-40)44-38(43)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17-20,37,39-40,42H,3-10,12,14-16,21-35H2,1-2H3 |
| InChIKey | XVUBDIVWLDPZEX-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.98 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|