C38H68O6 — CID 90974122
(3-hexadec-9-enoyloxy-1-hydroxy-4-oxohexan-2-yl) hexadec-9-enoate (PubChem CID 90974122) has the molecular formula C38H68O6 and a molecular weight of 620.96 g/mol. Its IUPAC name is (3-hexadec-9-enoyloxy-1-hydroxy-4-oxohexan-2-yl) hexadec-9-enoate.
| Compound Name | (3-hexadec-9-enoyloxy-1-hydroxy-4-oxohexan-2-yl) hexadec-9-enoate |
|---|---|
| PubChem CID | 90974122 |
| Molecular Formula | C38H68O6 |
| Molecular Weight | 620.96 g/mol |
| Exact Mass | 620.50 |
| IUPAC Name | (3-hexadec-9-enoyloxy-1-hydroxy-4-oxohexan-2-yl) hexadec-9-enoate |
| SMILES | CCCCCCC=CCCCCCCCC(=O)OC(CO)C(OC(=O)CCCCCCCC=CCCCCCC)C(=O)CC |
| InChI | InChI=1S/C38H68O6/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-36(41)43-35(33-39)38(34(40)6-3)44-37(42)32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h15-18,35,38-39H,4-14,19-33H2,1-3H3 |
| InChIKey | FFTXBLVJUQMJMT-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.96 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|