C44H84N2O4 — CID 76724276
[1,4-bis(dimethylamino)-3-octadec-9-enoyloxybutan-2-yl] octadec-9-enoate (PubChem CID 76724276) has the molecular formula C44H84N2O4 and a molecular weight of 705.17 g/mol. Its IUPAC name is [1,4-bis(dimethylamino)-3-octadec-9-enoyloxybutan-2-yl] octadec-9-enoate.
| Compound Name | [1,4-bis(dimethylamino)-3-octadec-9-enoyloxybutan-2-yl] octadec-9-enoate |
|---|---|
| PubChem CID | 76724276 |
| Molecular Formula | C44H84N2O4 |
| Molecular Weight | 705.17 g/mol |
| Exact Mass | 704.64 |
| IUPAC Name | [1,4-bis(dimethylamino)-3-octadec-9-enoyloxybutan-2-yl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(CN(C)C)C(CN(C)C)OC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C44H84N2O4/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-43(47)49-41(39-45(3)4)42(40-46(5)6)50-44(48)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2/h21-24,41-42H,7-20,25-40H2,1-6H3 |
| InChIKey | STXCUOPKXFUSMA-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.17 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|